About N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide
N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide (PubChem CID 9206072) has the molecular formula C17H14ClF2NO3
and a molecular weight of 353.75 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide |
| PubChem CID | 9206072 |
| Molecular Formula | C17H14ClF2NO3 |
| Molecular Weight | 353.75 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C17H14ClF2NO3/c1-2-21(8-10-3-4-15-16(5-10)24-9-23-15)17(22)11-6-13(19)14(20)7-12(11)18/h3-7H,2,8-9H2,1H3 |
| InChIKey | XNHIBCIXQJAGCM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.75 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide?
The IUPAC name of N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide (CID 9206072) is N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide.
What is the SMILES notation for N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide?
The canonical SMILES for N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide is CCN(Cc1ccc2c(c1)OCO2)C(=O)c1cc(F)c(F)cc1Cl.
What is the InChIKey of N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide?
The InChIKey is XNHIBCIXQJAGCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClF2NO3/c1-2-21(8-10-3-4-15-16(5-10)24-9-23-15)17(22)11-6-13(19)14(20)7-12(11)18/h3-7H,2,8-9H2,1H3.
What are the key properties of N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide?
N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide has a molecular weight of 353.75 g/mol, XLogP of 4.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-ylmethyl)-2-chloro-N-ethyl-4,5-difluorobenzamide is sourced from PubChem (CID 9206072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).