C23H21N3O2S — CID 9206546
N'-benzyl-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]-N'-phenylacetohydrazide (PubChem CID 9206546) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is N'-benzyl-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]-N'-phenylacetohydrazide.
| Compound Name | N'-benzyl-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 9206546 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N'-benzyl-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]-N'-phenylacetohydrazide |
| SMILES | O=C(C[C@H]1Sc2ccccc2NC1=O)NN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21N3O2S/c27-22(15-21-23(28)24-19-13-7-8-14-20(19)29-21)25-26(18-11-5-2-6-12-18)16-17-9-3-1-4-10-17/h1-14,21H,15-16H2,(H,24,28)(H,25,27)/t21-/m1/s1 |
| InChIKey | NFRDJHIWJJKDCP-OAQYLSRUSA-N |
| XLogP | 4.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|