C19H20N2O2 — CID 9206772
2-(1,2-benzoxazol-3-yl)-N-(4-butylphenyl)acetamide (PubChem CID 9206772) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-(4-butylphenyl)acetamide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-(4-butylphenyl)acetamide |
|---|---|
| PubChem CID | 9206772 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-(4-butylphenyl)acetamide |
| SMILES | CCCCc1ccc(NC(=O)Cc2noc3ccccc23)cc1 |
| InChI | InChI=1S/C19H20N2O2/c1-2-3-6-14-9-11-15(12-10-14)20-19(22)13-17-16-7-4-5-8-18(16)23-21-17/h4-5,7-12H,2-3,6,13H2,1H3,(H,20,22) |
| InChIKey | POSZQVBLKPIYSW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |