C18H14F6N2O2 — CID 9207196
2-(4-acetamidophenyl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide (PubChem CID 9207196) has the molecular formula C18H14F6N2O2 and a molecular weight of 404.31 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-acetamidophenyl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9207196 |
| Molecular Formula | C18H14F6N2O2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-(4-acetamidophenyl)-N-[3,5-bis(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H14F6N2O2/c1-10(27)25-14-4-2-11(3-5-14)6-16(28)26-15-8-12(17(19,20)21)7-13(9-15)18(22,23)24/h2-5,7-9H,6H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | KLAMSJSJPFAHDO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |