C22H21ClN4O2 — CID 9207440
(2R)-5-chloro-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 9207440) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is (2R)-5-chloro-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2R)-5-chloro-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9207440 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (2R)-5-chloro-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nnc3n2CCCCC3)c1)[C@H]1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C22H21ClN4O2/c23-16-8-9-18-15(11-16)13-19(29-18)22(28)24-17-6-4-5-14(12-17)21-26-25-20-7-2-1-3-10-27(20)21/h4-6,8-9,11-12,19H,1-3,7,10,13H2,(H,24,28)/t19-/m1/s1 |
| InChIKey | UJHCDAPPQSTZAQ-LJQANCHMSA-N |
| XLogP | 4.27 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |