C13H18F3N3O3 — CID 9207452
2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 9207452) has the molecular formula C13H18F3N3O3 and a molecular weight of 321.30 g/mol. Its IUPAC name is 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 9207452 |
| Molecular Formula | C13H18F3N3O3 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)NCC(F)(F)F)C2=O |
| InChI | InChI=1S/C13H18F3N3O3/c1-8-2-4-12(5-3-8)10(21)19(11(22)18-12)6-9(20)17-7-13(14,15)16/h8H,2-7H2,1H3,(H,17,20)(H,18,22) |
| InChIKey | JTYATNIOPWAGGQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|