C21H28N2O4S — CID 9208122
(2S)-2-[(4-tert-butylphenyl)sulfonylamino]-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 9208122) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is (2S)-2-[(4-tert-butylphenyl)sulfonylamino]-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | (2S)-2-[(4-tert-butylphenyl)sulfonylamino]-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 9208122 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (2S)-2-[(4-tert-butylphenyl)sulfonylamino]-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)[C@H](C)NS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O4S/c1-15(20(24)22-14-16-6-10-18(27-5)11-7-16)23-28(25,26)19-12-8-17(9-13-19)21(2,3)4/h6-13,15,23H,14H2,1-5H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | QSNWGJVVKKSVPB-HNNXBMFYSA-N |
| XLogP | 2.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |