About quinazoline
quinazoline (PubChem CID 9210) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is quinazoline.
Molecular Properties
| Compound Name | quinazoline |
| PubChem CID | 9210 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | quinazoline |
| SMILES | c1ccc2ncncc2c1 |
| InChI | InChI=1S/C8H6N2/c1-2-4-8-7(3-1)5-9-6-10-8/h1-6H |
| InChIKey | JWVCLYRUEFBMGU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinazoline?
The IUPAC name of quinazoline (CID 9210) is quinazoline.
What is the SMILES notation for quinazoline?
The canonical SMILES for quinazoline is c1ccc2ncncc2c1.
What is the InChIKey of quinazoline?
The InChIKey is JWVCLYRUEFBMGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c1-2-4-8-7(3-1)5-9-6-10-8/h1-6H.
What are the key properties of quinazoline?
quinazoline has a molecular weight of 130.15 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinazoline is sourced from PubChem (CID 9210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).