C15H18ClN3O6S — CID 9210195
4-chloro-N-[(2R)-1-(cyclopropylamino)-4-methylsulfonyl-1-oxobutan-2-yl]-3-nitrobenzamide (PubChem CID 9210195) has the molecular formula C15H18ClN3O6S and a molecular weight of 403.84 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-1-(cyclopropylamino)-4-methylsulfonyl-1-oxobutan-2-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[(2R)-1-(cyclopropylamino)-4-methylsulfonyl-1-oxobutan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9210195 |
| Molecular Formula | C15H18ClN3O6S |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 4-chloro-N-[(2R)-1-(cyclopropylamino)-4-methylsulfonyl-1-oxobutan-2-yl]-3-nitrobenzamide |
| SMILES | CS(=O)(=O)CC[C@@H](NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)NC1CC1 |
| InChI | InChI=1S/C15H18ClN3O6S/c1-26(24,25)7-6-12(15(21)17-10-3-4-10)18-14(20)9-2-5-11(16)13(8-9)19(22)23/h2,5,8,10,12H,3-4,6-7H2,1H3,(H,17,21)(H,18,20)/t12-/m1/s1 |
| InChIKey | UIETVLMMCMCUKT-GFCCVEGCSA-N |
| XLogP | 1.06 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|