C18H25N3 — CID 921145
4,10-dimethyl-5-(piperidin-1-ylmethyl)-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene (PubChem CID 921145) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 4,10-dimethyl-5-(piperidin-1-ylmethyl)-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene.
| Compound Name | 4,10-dimethyl-5-(piperidin-1-ylmethyl)-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
|---|---|
| PubChem CID | 921145 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 4,10-dimethyl-5-(piperidin-1-ylmethyl)-6,9-diazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
| SMILES | Cc1cc2n(c1CN1CCCCC1)CCn1c(C)ccc1-2 |
| InChI | InChI=1S/C18H25N3/c1-14-12-17-16-7-6-15(2)20(16)10-11-21(17)18(14)13-19-8-4-3-5-9-19/h6-7,12H,3-5,8-11,13H2,1-2H3 |
| InChIKey | BAOFKHFGYMOQPA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|