C19H22N2O4 — CID 9212454
N-[(Z)-1-(2,5-diethoxyphenyl)ethylideneamino]-2-hydroxybenzamide (PubChem CID 9212454) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-diethoxyphenyl)ethylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[(Z)-1-(2,5-diethoxyphenyl)ethylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 9212454 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[(Z)-1-(2,5-diethoxyphenyl)ethylideneamino]-2-hydroxybenzamide |
| SMILES | CCOc1ccc(OCC)c(/C(C)=N\NC(=O)c2ccccc2O)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-4-24-14-10-11-18(25-5-2)16(12-14)13(3)20-21-19(23)15-8-6-7-9-17(15)22/h6-12,22H,4-5H2,1-3H3,(H,21,23)/b20-13- |
| InChIKey | AKRHMSWZOYDMJJ-MOSHPQCFSA-N |
| XLogP | 3.34 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|