About N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide
N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide (PubChem CID 921277) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide |
| PubChem CID | 921277 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide |
| SMILES | CCN(CCO)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-2-19(13-14-20)18(21)17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17,20H,2,13-14H2,1H3 |
| InChIKey | QMTONKNVKCJFFJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide?
The IUPAC name of N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide (CID 921277) is N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide.
What is the SMILES notation for N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide?
The canonical SMILES for N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide is CCN(CCO)C(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide?
The InChIKey is QMTONKNVKCJFFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-2-19(13-14-20)18(21)17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17,20H,2,13-14H2,1H3.
What are the key properties of N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide?
N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide has a molecular weight of 283.37 g/mol, XLogP of 2.66, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(2-hydroxyethyl)-2,2-diphenylacetamide is sourced from PubChem (CID 921277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).