About 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide
2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide (PubChem CID 921280) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide.
Molecular Properties
| Compound Name | 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide |
| PubChem CID | 921280 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide |
| SMILES | Cc1ccc(C(O)(C(=O)NN)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H18N2O2/c1-11-3-7-13(8-4-11)16(20,15(19)18-17)14-9-5-12(2)6-10-14/h3-10,20H,17H2,1-2H3,(H,18,19) |
| InChIKey | CNBPXMYTRDVLPQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide?
The IUPAC name of 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide (CID 921280) is 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide.
What is the SMILES notation for 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide?
The canonical SMILES for 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide is Cc1ccc(C(O)(C(=O)NN)c2ccc(C)cc2)cc1.
What is the InChIKey of 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide?
The InChIKey is CNBPXMYTRDVLPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-11-3-7-13(8-4-11)16(20,15(19)18-17)14-9-5-12(2)6-10-14/h3-10,20H,17H2,1-2H3,(H,18,19).
What are the key properties of 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide?
2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide has a molecular weight of 270.33 g/mol, XLogP of 1.53, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2,2-bis(4-methylphenyl)acetohydrazide is sourced from PubChem (CID 921280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).