C17H20N4O3 — CID 9213540
N-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide (PubChem CID 9213540) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide.
| Compound Name | N-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 9213540 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-[(Z)-2,3-dihydroinden-1-ylideneamino]-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
| SMILES | CC1(C)NC(=O)N(CCC(=O)N/N=C2/CCc3ccccc32)C1=O |
| InChI | InChI=1S/C17H20N4O3/c1-17(2)15(23)21(16(24)18-17)10-9-14(22)20-19-13-8-7-11-5-3-4-6-12(11)13/h3-6H,7-10H2,1-2H3,(H,18,24)(H,20,22)/b19-13- |
| InChIKey | XQWSBQGYCRAOTJ-UYRXBGFRSA-N |
| XLogP | 1.17 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|