C19H17F2N3O3 — CID 9213858
(3Z)-3-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylidenehydrazinylidene]-1-methylindol-2-one (PubChem CID 9213858) has the molecular formula C19H17F2N3O3 and a molecular weight of 373.36 g/mol. Its IUPAC name is (3Z)-3-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylidenehydrazinylidene]-1-methylindol-2-one.
| Compound Name | (3Z)-3-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylidenehydrazinylidene]-1-methylindol-2-one |
|---|---|
| PubChem CID | 9213858 |
| Molecular Formula | C19H17F2N3O3 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (3Z)-3-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylidenehydrazinylidene]-1-methylindol-2-one |
| SMILES | CCOc1cc(/C=N\N=C2/C(=O)N(C)c3ccccc32)ccc1OC(F)F |
| InChI | InChI=1S/C19H17F2N3O3/c1-3-26-16-10-12(8-9-15(16)27-19(20)21)11-22-23-17-13-6-4-5-7-14(13)24(2)18(17)25/h4-11,19H,3H2,1-2H3/b22-11-,23-17- |
| InChIKey | VRRNHFNMYQEPBR-FRKLDOROSA-N |
| XLogP | 3.49 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|