C13H11Cl3N4O — CID 9214710
4-amino-N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,5,6-trichloropyridine-2-carboxamide (PubChem CID 9214710) has the molecular formula C13H11Cl3N4O and a molecular weight of 345.62 g/mol. Its IUPAC name is 4-amino-N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,5,6-trichloropyridine-2-carboxamide.
| Compound Name | 4-amino-N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,5,6-trichloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 9214710 |
| Molecular Formula | C13H11Cl3N4O |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 4-amino-N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-3,5,6-trichloropyridine-2-carboxamide |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)N/N=C2/C[C@@H]3C=CC[C@@H]23)c1Cl |
| InChI | InChI=1S/C13H11Cl3N4O/c14-8-10(17)9(15)12(16)18-11(8)13(21)20-19-7-4-5-2-1-3-6(5)7/h1-2,5-6H,3-4H2,(H2,17,18)(H,20,21)/b19-7-/t5-,6+/m0/s1 |
| InChIKey | BMGDJAKJQRFAJL-ATDVRCTASA-N |
| XLogP | 3.31 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|