About 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol
2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol (PubChem CID 921675) has the molecular formula C10H7F2NO2
and a molecular weight of 211.17 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol.
Molecular Properties
| Compound Name | 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol |
| PubChem CID | 921675 |
| Molecular Formula | C10H7F2NO2 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol |
| SMILES | Oc1ccccc1-c1cc(C(F)F)no1 |
| InChI | InChI=1S/C10H7F2NO2/c11-10(12)7-5-9(15-13-7)6-3-1-2-4-8(6)14/h1-5,10,14H |
| InChIKey | QXYFXJLVGVXIQX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol?
The IUPAC name of 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol (CID 921675) is 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol.
What is the SMILES notation for 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol?
The canonical SMILES for 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol is Oc1ccccc1-c1cc(C(F)F)no1.
What is the InChIKey of 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol?
The InChIKey is QXYFXJLVGVXIQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2NO2/c11-10(12)7-5-9(15-13-7)6-3-1-2-4-8(6)14/h1-5,10,14H.
What are the key properties of 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol?
2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol has a molecular weight of 211.17 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(difluoromethyl)-1,2-oxazol-5-yl]phenol is sourced from PubChem (CID 921675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).