About phenoxathiine
phenoxathiine (PubChem CID 9217) has the molecular formula C12H8OS
and a molecular weight of 200.26 g/mol. Its IUPAC name is phenoxathiine.
Molecular Properties
| Compound Name | phenoxathiine |
| PubChem CID | 9217 |
| Molecular Formula | C12H8OS |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | phenoxathiine |
| SMILES | c1ccc2c(c1)Oc1ccccc1S2 |
| InChI | InChI=1S/C12H8OS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8H |
| InChIKey | GJSGGHOYGKMUPT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxathiine?
The IUPAC name of phenoxathiine (CID 9217) is phenoxathiine.
What is the SMILES notation for phenoxathiine?
The canonical SMILES for phenoxathiine is c1ccc2c(c1)Oc1ccccc1S2.
What is the InChIKey of phenoxathiine?
The InChIKey is GJSGGHOYGKMUPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8OS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8H.
What are the key properties of phenoxathiine?
phenoxathiine has a molecular weight of 200.26 g/mol, XLogP of 3.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxathiine is sourced from PubChem (CID 9217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).