About 1H-pyrrolo[2,3-c]pyridine
1H-pyrrolo[2,3-c]pyridine (PubChem CID 9219) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 1H-pyrrolo[2,3-c]pyridine |
| PubChem CID | 9219 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 1H-pyrrolo[2,3-c]pyridine |
| SMILES | c1cc2cc[nH]c2cn1 |
| InChI | InChI=1S/C7H6N2/c1-3-8-5-7-6(1)2-4-9-7/h1-5,9H |
| InChIKey | XLKDJOPOOHHZAN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[2,3-c]pyridine?
The IUPAC name of 1H-pyrrolo[2,3-c]pyridine (CID 9219) is 1H-pyrrolo[2,3-c]pyridine.
What is the SMILES notation for 1H-pyrrolo[2,3-c]pyridine?
The canonical SMILES for 1H-pyrrolo[2,3-c]pyridine is c1cc2cc[nH]c2cn1.
What is the InChIKey of 1H-pyrrolo[2,3-c]pyridine?
The InChIKey is XLKDJOPOOHHZAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2/c1-3-8-5-7-6(1)2-4-9-7/h1-5,9H.
What are the key properties of 1H-pyrrolo[2,3-c]pyridine?
1H-pyrrolo[2,3-c]pyridine has a molecular weight of 118.14 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 9219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).