About N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide
N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide (PubChem CID 922337) has the molecular formula C14H16Cl2N2O2
and a molecular weight of 315.20 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide |
| PubChem CID | 922337 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide |
| SMILES | O=C(NN=Cc1cc(Cl)cc(Cl)c1O)C1CCCCC1 |
| InChI | InChI=1S/C14H16Cl2N2O2/c15-11-6-10(13(19)12(16)7-11)8-17-18-14(20)9-4-2-1-3-5-9/h6-9,19H,1-5H2,(H,18,20) |
| InChIKey | QNIABENHHIHWBC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide?
The IUPAC name of N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide (CID 922337) is N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide.
What is the SMILES notation for N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide?
The canonical SMILES for N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide is O=C(NN=Cc1cc(Cl)cc(Cl)c1O)C1CCCCC1.
What is the InChIKey of N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide?
The InChIKey is QNIABENHHIHWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2N2O2/c15-11-6-10(13(19)12(16)7-11)8-17-18-14(20)9-4-2-1-3-5-9/h6-9,19H,1-5H2,(H,18,20).
What are the key properties of N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide?
N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide has a molecular weight of 315.20 g/mol, XLogP of 3.73, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexanecarboxamide is sourced from PubChem (CID 922337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).