C20H33N3O5S — CID 9223924
tert-butyl N-[3-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]amino]-3-oxopropyl]carbamate (PubChem CID 9223924) has the molecular formula C20H33N3O5S and a molecular weight of 427.57 g/mol. Its IUPAC name is tert-butyl N-[3-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 9223924 |
| Molecular Formula | C20H33N3O5S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | tert-butyl N-[3-[[(1S)-1-[4-(diethylsulfamoyl)phenyl]ethyl]amino]-3-oxopropyl]carbamate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc([C@H](C)NC(=O)CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H33N3O5S/c1-7-23(8-2)29(26,27)17-11-9-16(10-12-17)15(3)22-18(24)13-14-21-19(25)28-20(4,5)6/h9-12,15H,7-8,13-14H2,1-6H3,(H,21,25)(H,22,24)/t15-/m0/s1 |
| InChIKey | YXXXIOIVPZBFAI-HNNXBMFYSA-N |
| XLogP | 2.81 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |