C18H27N3O4 — CID 9224516
2-ethoxy-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 9224516) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-ethoxy-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-ethoxy-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 9224516 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-ethoxy-N-[(2S)-1-[[2-(ethylamino)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCNC(=O)CNC(=O)[C@@H](NC(=O)c1ccccc1OCC)C(C)C |
| InChI | InChI=1S/C18H27N3O4/c1-5-19-15(22)11-20-18(24)16(12(3)4)21-17(23)13-9-7-8-10-14(13)25-6-2/h7-10,12,16H,5-6,11H2,1-4H3,(H,19,22)(H,20,24)(H,21,23)/t16-/m0/s1 |
| InChIKey | IHOFXDPHXPZMFB-INIZCTEOSA-N |
| XLogP | 1.09 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |