C21H28F3N3O — CID 9225531
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methanone (PubChem CID 9225531) has the molecular formula C21H28F3N3O and a molecular weight of 395.47 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 9225531 |
| Molecular Formula | C21H28F3N3O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ccc(C(F)(F)F)cn2)CC1)N1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C21H28F3N3O/c22-21(23,24)18-5-6-19(25-13-18)26-10-8-16(9-11-26)20(28)27-12-7-15-3-1-2-4-17(15)14-27/h5-6,13,15-17H,1-4,7-12,14H2/t15-,17+/m0/s1 |
| InChIKey | OUTAXOYADZAJBU-DOTOQJQBSA-N |
| XLogP | 4.36 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |