C19H20N4O — CID 9226484
1H-indol-2-yl-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone (PubChem CID 9226484) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 1H-indol-2-yl-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | 1H-indol-2-yl-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 9226484 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1H-indol-2-yl-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C19H20N4O/c24-19(18-13-16-3-1-2-4-17(16)21-18)23-11-9-22(10-12-23)14-15-5-7-20-8-6-15/h1-8,13,21H,9-12,14H2 |
| InChIKey | KNBALALVOBKOCR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |