C20H20N2O5 — CID 9228361
ethyl 3-[3-(3-oxo-1,4-benzoxazin-4-yl)propanoylamino]benzoate (PubChem CID 9228361) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl 3-[3-(3-oxo-1,4-benzoxazin-4-yl)propanoylamino]benzoate.
| Compound Name | ethyl 3-[3-(3-oxo-1,4-benzoxazin-4-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 9228361 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | ethyl 3-[3-(3-oxo-1,4-benzoxazin-4-yl)propanoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)CCN2C(=O)COc3ccccc32)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-2-26-20(25)14-6-5-7-15(12-14)21-18(23)10-11-22-16-8-3-4-9-17(16)27-13-19(22)24/h3-9,12H,2,10-11,13H2,1H3,(H,21,23) |
| InChIKey | TWADIBYRTUVAHP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |