C13H16N2O2S2 — CID 922864
(E)-N-[[(2S)-oxolan-2-yl]methylcarbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 922864) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is (E)-N-[[(2S)-oxolan-2-yl]methylcarbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[[(2S)-oxolan-2-yl]methylcarbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 922864 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (E)-N-[[(2S)-oxolan-2-yl]methylcarbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)NC(=S)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H16N2O2S2/c16-12(6-5-11-4-2-8-19-11)15-13(18)14-9-10-3-1-7-17-10/h2,4-6,8,10H,1,3,7,9H2,(H2,14,15,16,18)/b6-5+/t10-/m0/s1 |
| InChIKey | UAMYATIYJOLRJO-PORFMDCZSA-N |
| XLogP | 1.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|