C17H22N2O4 — CID 9229141
[2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 3,5-dimethylbenzoate (PubChem CID 9229141) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 3,5-dimethylbenzoate.
| Compound Name | [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 9229141 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCC(=O)N2CCC[C@@H](C(N)=O)C2)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-11-6-12(2)8-14(7-11)17(22)23-10-15(20)19-5-3-4-13(9-19)16(18)21/h6-8,13H,3-5,9-10H2,1-2H3,(H2,18,21)/t13-/m1/s1 |
| InChIKey | NGFYSXYPLFNECQ-CYBMUJFWSA-N |
| XLogP | 1.18 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |