C18H21FN4O2S2 — CID 9233585
methyl (2S)-4-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]thiomorpholine-2-carboxylate (PubChem CID 9233585) has the molecular formula C18H21FN4O2S2 and a molecular weight of 408.52 g/mol. Its IUPAC name is methyl (2S)-4-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]thiomorpholine-2-carboxylate.
| Compound Name | methyl (2S)-4-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 9233585 |
| Molecular Formula | C18H21FN4O2S2 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | methyl (2S)-4-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]thiomorpholine-2-carboxylate |
| SMILES | C=CCn1c(-c2ccc(F)cc2)nn(CN2CCS[C@H](C(=O)OC)C2)c1=S |
| InChI | InChI=1S/C18H21FN4O2S2/c1-3-8-22-16(13-4-6-14(19)7-5-13)20-23(18(22)26)12-21-9-10-27-15(11-21)17(24)25-2/h3-7,15H,1,8-12H2,2H3/t15-/m0/s1 |
| InChIKey | WUGGEJGDKLGUGR-HNNXBMFYSA-N |
| XLogP | 2.95 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|