About bicyclo[2.2.2]octane
bicyclo[2.2.2]octane (PubChem CID 9235) has the molecular formula C8H14
and a molecular weight of 110.20 g/mol. Its IUPAC name is bicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | bicyclo[2.2.2]octane |
| PubChem CID | 9235 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | bicyclo[2.2.2]octane |
| SMILES | C1CC2CCC1CC2 |
| InChI | InChI=1S/C8H14/c1-2-8-5-3-7(1)4-6-8/h7-8H,1-6H2 |
| InChIKey | GPRLTFBKWDERLU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.2]octane?
The IUPAC name of bicyclo[2.2.2]octane (CID 9235) is bicyclo[2.2.2]octane.
What is the SMILES notation for bicyclo[2.2.2]octane?
The canonical SMILES for bicyclo[2.2.2]octane is C1CC2CCC1CC2.
What is the InChIKey of bicyclo[2.2.2]octane?
The InChIKey is GPRLTFBKWDERLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14/c1-2-8-5-3-7(1)4-6-8/h7-8H,1-6H2.
What are the key properties of bicyclo[2.2.2]octane?
bicyclo[2.2.2]octane has a molecular weight of 110.20 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.2]octane is sourced from PubChem (CID 9235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).