C23H21N3O3S — CID 9235019
1-[4-[(3S)-3-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]pyrrolidine-2,5-dione (PubChem CID 9235019) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 1-[4-[(3S)-3-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[(3S)-3-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 9235019 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1-[4-[(3S)-3-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C(c1ccc(N2C(=O)CCC2=O)cc1)N1CCC[C@H](c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C23H21N3O3S/c27-20-11-12-21(28)26(20)17-9-7-15(8-10-17)23(29)25-13-3-4-16(14-25)22-24-18-5-1-2-6-19(18)30-22/h1-2,5-10,16H,3-4,11-14H2/t16-/m0/s1 |
| InChIKey | WOFUIBMAEJFYJA-INIZCTEOSA-N |
| XLogP | 3.97 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|