About tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate
tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate (PubChem CID 9235466) has the molecular formula C11H14F2N2O4S
and a molecular weight of 308.31 g/mol. Its IUPAC name is tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate |
| PubChem CID | 9235466 |
| Molecular Formula | C11H14F2N2O4S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H14F2N2O4S/c1-11(2,3)19-10(16)14-15-20(17,18)9-6-7(12)4-5-8(9)13/h4-6,15H,1-3H3,(H,14,16) |
| InChIKey | IBYKCZGGBAEAPJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate?
The IUPAC name of tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate (CID 9235466) is tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate.
What is the SMILES notation for tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate?
The canonical SMILES for tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate is CC(C)(C)OC(=O)NNS(=O)(=O)c1cc(F)ccc1F.
What is the InChIKey of tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate?
The InChIKey is IBYKCZGGBAEAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2N2O4S/c1-11(2,3)19-10(16)14-15-20(17,18)9-6-7(12)4-5-8(9)13/h4-6,15H,1-3H3,(H,14,16).
What are the key properties of tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate?
tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate has a molecular weight of 308.31 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2,5-difluorophenyl)sulfonylamino]carbamate is sourced from PubChem (CID 9235466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).