C20H25N4S+ — CID 9236082
4,5-dicyclopropyl-2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 9236082) has the molecular formula C20H25N4S+ and a molecular weight of 353.51 g/mol. Its IUPAC name is 4,5-dicyclopropyl-2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4,5-dicyclopropyl-2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9236082 |
| Molecular Formula | C20H25N4S+ |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 4,5-dicyclopropyl-2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | S=c1n(C[NH+]2CC=C(c3ccccc3)CC2)nc(C2CC2)n1C1CC1 |
| InChI | InChI=1S/C20H24N4S/c25-20-23(21-19(17-6-7-17)24(20)18-8-9-18)14-22-12-10-16(11-13-22)15-4-2-1-3-5-15/h1-5,10,17-18H,6-9,11-14H2/p+1 |
| InChIKey | RHDICCISCCKNBU-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 27.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|