C23H31N4O2S+ — CID 9236212
ethyl 2-[4-cyclopentyl-1-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-5-sulfanylidene-1,2,4-triazol-3-yl]acetate (PubChem CID 9236212) has the molecular formula C23H31N4O2S+ and a molecular weight of 427.59 g/mol. Its IUPAC name is ethyl 2-[4-cyclopentyl-1-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-5-sulfanylidene-1,2,4-triazol-3-yl]acetate.
| Compound Name | ethyl 2-[4-cyclopentyl-1-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-5-sulfanylidene-1,2,4-triazol-3-yl]acetate |
|---|---|
| PubChem CID | 9236212 |
| Molecular Formula | C23H31N4O2S+ |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | ethyl 2-[4-cyclopentyl-1-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-5-sulfanylidene-1,2,4-triazol-3-yl]acetate |
| SMILES | CCOC(=O)Cc1nn(C[NH+]2CC=C(c3ccccc3)CC2)c(=S)n1C1CCCC1 |
| InChI | InChI=1S/C23H30N4O2S/c1-2-29-22(28)16-21-24-26(23(30)27(21)20-10-6-7-11-20)17-25-14-12-19(13-15-25)18-8-4-3-5-9-18/h3-5,8-9,12,20H,2,6-7,10-11,13-17H2,1H3/p+1 |
| InChIKey | HVBPUFZXBZWCPP-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|