About 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide
2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide (PubChem CID 9237065) has the molecular formula C18H22F2N2O3S
and a molecular weight of 384.45 g/mol. Its IUPAC name is 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide |
| PubChem CID | 9237065 |
| Molecular Formula | C18H22F2N2O3S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NNS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H22F2N2O3S/c19-14-1-2-15(20)16(6-14)26(24,25)22-21-17(23)10-18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,11-13,22H,3-5,7-10H2,(H,21,23) |
| InChIKey | SORJFXKCYQPYFZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide?
The IUPAC name of 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide (CID 9237065) is 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide.
What is the SMILES notation for 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide?
The canonical SMILES for 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide is O=C(CC12CC3CC(CC(C3)C1)C2)NNS(=O)(=O)c1cc(F)ccc1F.
What is the InChIKey of 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide?
The InChIKey is SORJFXKCYQPYFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F2N2O3S/c19-14-1-2-15(20)16(6-14)26(24,25)22-21-17(23)10-18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,11-13,22H,3-5,7-10H2,(H,21,23).
What are the key properties of 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide?
2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide has a molecular weight of 384.45 g/mol, XLogP of 2.88, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-N'-(2,5-difluorophenyl)sulfonylacetohydrazide is sourced from PubChem (CID 9237065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).