C19H26BrN3OS — CID 9237940
4-(azepane-1-carbonyl)-N-(3-bromophenyl)piperidine-1-carbothioamide (PubChem CID 9237940) has the molecular formula C19H26BrN3OS and a molecular weight of 424.41 g/mol. Its IUPAC name is 4-(azepane-1-carbonyl)-N-(3-bromophenyl)piperidine-1-carbothioamide.
| Compound Name | 4-(azepane-1-carbonyl)-N-(3-bromophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 9237940 |
| Molecular Formula | C19H26BrN3OS |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 4-(azepane-1-carbonyl)-N-(3-bromophenyl)piperidine-1-carbothioamide |
| SMILES | O=C(C1CCN(C(=S)Nc2cccc(Br)c2)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C19H26BrN3OS/c20-16-6-5-7-17(14-16)21-19(25)23-12-8-15(9-13-23)18(24)22-10-3-1-2-4-11-22/h5-7,14-15H,1-4,8-13H2,(H,21,25) |
| InChIKey | NLPGECCPHIXUAC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|