C20H22N6O2 — CID 9238289
3-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9238289) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 3-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9238289 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-[(Z)-[(E)-3-(1-benzyltriazol-4-yl)prop-2-enylidene]amino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1/N=C\C=C\c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C20H22N6O2/c27-18-20(11-5-2-6-12-20)22-19(28)26(18)21-13-7-10-17-15-25(24-23-17)14-16-8-3-1-4-9-16/h1,3-4,7-10,13,15H,2,5-6,11-12,14H2,(H,22,28)/b10-7+,21-13- |
| InChIKey | ZRWPSBLJTMGABF-VIBAAIGISA-N |
| XLogP | 2.58 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|