C20H28N3O6+ — CID 9238450
methyl (2S,4S)-1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]-4-hydroxypyrrolidin-1-ium-2-carboxylate (PubChem CID 9238450) has the molecular formula C20H28N3O6+ and a molecular weight of 406.46 g/mol. Its IUPAC name is methyl (2S,4S)-1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]-4-hydroxypyrrolidin-1-ium-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]-4-hydroxypyrrolidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 9238450 |
| Molecular Formula | C20H28N3O6+ |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | methyl (2S,4S)-1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]-4-hydroxypyrrolidin-1-ium-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](O)C[NH+]1CN1C(=O)C(=O)N(C23CC4CC(CC(C4)C2)C3)C1=O |
| InChI | InChI=1S/C20H27N3O6/c1-29-18(27)15-5-14(24)9-21(15)10-22-16(25)17(26)23(19(22)28)20-6-11-2-12(7-20)4-13(3-11)8-20/h11-15,24H,2-10H2,1H3/p+1/t11?,12?,13?,14-,15-,20?/m0/s1 |
| InChIKey | NKLHWDDJALZWMP-JCBMKPRTSA-O |
| XLogP | -1.11 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|