About 2,4,10-trioxatricyclo[3.3.1.13,7]decane
2,4,10-trioxatricyclo[3.3.1.13,7]decane (PubChem CID 9239) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 2,4,10-trioxatricyclo[3.3.1.13,7]decane.
Molecular Properties
| Compound Name | 2,4,10-trioxatricyclo[3.3.1.13,7]decane |
| PubChem CID | 9239 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 2,4,10-trioxatricyclo[3.3.1.13,7]decane |
| SMILES | C1C2CC3CC1OC(O2)O3 |
| InChI | InChI=1S/C7H10O3/c1-4-2-6-3-5(1)9-7(8-4)10-6/h4-7H,1-3H2 |
| InChIKey | VUIDKQHXAUDXKD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4,10-trioxatricyclo[3.3.1.13,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,10-trioxatricyclo[3.3.1.13,7]decane?
The IUPAC name of 2,4,10-trioxatricyclo[3.3.1.13,7]decane (CID 9239) is 2,4,10-trioxatricyclo[3.3.1.13,7]decane.
What is the SMILES notation for 2,4,10-trioxatricyclo[3.3.1.13,7]decane?
The canonical SMILES for 2,4,10-trioxatricyclo[3.3.1.13,7]decane is C1C2CC3CC1OC(O2)O3.
What is the InChIKey of 2,4,10-trioxatricyclo[3.3.1.13,7]decane?
The InChIKey is VUIDKQHXAUDXKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-4-2-6-3-5(1)9-7(8-4)10-6/h4-7H,1-3H2.
What are the key properties of 2,4,10-trioxatricyclo[3.3.1.13,7]decane?
2,4,10-trioxatricyclo[3.3.1.13,7]decane has a molecular weight of 142.15 g/mol, XLogP of 0.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,10-trioxatricyclo[3.3.1.13,7]decane is sourced from PubChem (CID 9239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).