C21H25N3O2S — CID 9239016
1-[(3-ethylphenyl)carbamothioyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 9239016) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is 1-[(3-ethylphenyl)carbamothioyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(3-ethylphenyl)carbamothioyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9239016 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1-[(3-ethylphenyl)carbamothioyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | CCc1cccc(NC(=S)N2CCC(C(=O)Nc3ccccc3O)CC2)c1 |
| InChI | InChI=1S/C21H25N3O2S/c1-2-15-6-5-7-17(14-15)22-21(27)24-12-10-16(11-13-24)20(26)23-18-8-3-4-9-19(18)25/h3-9,14,16,25H,2,10-13H2,1H3,(H,22,27)(H,23,26) |
| InChIKey | IASBLXRMKWNQOO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|