C20H19FN4O2S — CID 9239794
4-[(Z)-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 9239794) has the molecular formula C20H19FN4O2S and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-[(Z)-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9239794 |
| Molecular Formula | C20H19FN4O2S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 4-[(Z)-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc2c(cc1/C=N\n1c(-c3cccc(F)c3)n[nH]c1=S)O[C@H](C)C2 |
| InChI | InChI=1S/C20H19FN4O2S/c1-3-26-17-9-14-7-12(2)27-18(14)10-15(17)11-22-25-19(23-24-20(25)28)13-5-4-6-16(21)8-13/h4-6,8-12H,3,7H2,1-2H3,(H,24,28)/b22-11-/t12-/m1/s1 |
| InChIKey | HBOPSUBEXUPPLL-HTGCFNNUSA-N |
| XLogP | 4.35 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|