C15H17Cl2N3O3 — CID 9241221
1-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-3-propylimidazolidine-2,4,5-trione (PubChem CID 9241221) has the molecular formula C15H17Cl2N3O3 and a molecular weight of 358.23 g/mol. Its IUPAC name is 1-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-3-propylimidazolidine-2,4,5-trione.
| Compound Name | 1-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-3-propylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9241221 |
| Molecular Formula | C15H17Cl2N3O3 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 1-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-3-propylimidazolidine-2,4,5-trione |
| SMILES | CCCN1C(=O)C(=O)N(CN(C)Cc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C15H17Cl2N3O3/c1-3-6-19-13(21)14(22)20(15(19)23)9-18(2)8-10-4-5-11(16)12(17)7-10/h4-5,7H,3,6,8-9H2,1-2H3 |
| InChIKey | YGKULLMQECFWSY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|