C19H22N4O3S — CID 9241597
1-[[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-propan-2-ylimidazolidine-2,4,5-trione (PubChem CID 9241597) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-[[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-propan-2-ylimidazolidine-2,4,5-trione.
| Compound Name | 1-[[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-propan-2-ylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9241597 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-[[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-propan-2-ylimidazolidine-2,4,5-trione |
| SMILES | CC(C)N1C(=O)C(=O)N(CN2CCC(c3nc4ccccc4s3)CC2)C1=O |
| InChI | InChI=1S/C19H22N4O3S/c1-12(2)23-18(25)17(24)22(19(23)26)11-21-9-7-13(8-10-21)16-20-14-5-3-4-6-15(14)27-16/h3-6,12-13H,7-11H2,1-2H3 |
| InChIKey | WAOUDBPTZDDXGB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|