C14H17ClN3OS+ — CID 9242071
5-(3-chlorophenyl)-3-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione (PubChem CID 9242071) has the molecular formula C14H17ClN3OS+ and a molecular weight of 310.83 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(3-chlorophenyl)-3-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 9242071 |
| Molecular Formula | C14H17ClN3OS+ |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 5-(3-chlorophenyl)-3-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1oc(-c2cccc(Cl)c2)nn1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C14H16ClN3OS/c15-12-6-4-5-11(9-12)13-16-18(14(20)19-13)10-17-7-2-1-3-8-17/h4-6,9H,1-3,7-8,10H2/p+1 |
| InChIKey | GFFDBTUSQODVLB-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 35.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|