About [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium
[(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium (PubChem CID 9242132) has the molecular formula C17H28NO3S+
and a molecular weight of 326.48 g/mol. Its IUPAC name is [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium.
Molecular Properties
| Compound Name | [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium |
| PubChem CID | 9242132 |
| Molecular Formula | C17H28NO3S+ |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium |
| SMILES | CC[NH+](Cc1cc(C(C)C)c(C)cc1O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H27NO3S/c1-5-18(15-6-7-22(20,21)11-15)10-14-9-16(12(2)3)13(4)8-17(14)19/h8-9,12,15,19H,5-7,10-11H2,1-4H3/p+1/t15-/m1/s1 |
| InChIKey | ALNFSNIFZVZQIQ-OAHLLOKOSA-O |
| XLogP | 1.42 |
| TPSA | 58.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium?
The IUPAC name of [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium (CID 9242132) is [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium.
What is the SMILES notation for [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium?
The canonical SMILES for [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium is CC[NH+](Cc1cc(C(C)C)c(C)cc1O)[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium?
The InChIKey is ALNFSNIFZVZQIQ-OAHLLOKOSA-O. The full InChI is InChI=1S/C17H27NO3S/c1-5-18(15-6-7-22(20,21)11-15)10-14-9-16(12(2)3)13(4)8-17(14)19/h8-9,12,15,19H,5-7,10-11H2,1-4H3/p+1/t15-/m1/s1.
What are the key properties of [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium?
[(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium has a molecular weight of 326.48 g/mol, XLogP of 1.42, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1,1-dioxothiolan-3-yl]-ethyl-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]azanium is sourced from PubChem (CID 9242132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).