C13H18N3O4S2+ — CID 9242790
[(3S)-1,1-dioxothiolan-3-yl]-ethyl-[[5-(furan-2-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium (PubChem CID 9242790) has the molecular formula C13H18N3O4S2+ and a molecular weight of 344.44 g/mol. Its IUPAC name is [(3S)-1,1-dioxothiolan-3-yl]-ethyl-[[5-(furan-2-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium.
| Compound Name | [(3S)-1,1-dioxothiolan-3-yl]-ethyl-[[5-(furan-2-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium |
|---|---|
| PubChem CID | 9242790 |
| Molecular Formula | C13H18N3O4S2+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | [(3S)-1,1-dioxothiolan-3-yl]-ethyl-[[5-(furan-2-yl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl]azanium |
| SMILES | CC[NH+](Cn1nc(-c2ccco2)oc1=S)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17N3O4S2/c1-2-15(10-5-7-22(17,18)8-10)9-16-13(21)20-12(14-16)11-4-3-6-19-11/h3-4,6,10H,2,5,7-9H2,1H3/p+1/t10-/m0/s1 |
| InChIKey | YOSKVMWTGLFKLM-JTQLQIEISA-O |
| XLogP | 0.51 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|