C15H21N5OS — CID 9243233
1-(3,4-dimethylphenyl)-4-[[(3R)-3-hydroxypiperidin-1-yl]methyl]tetrazole-5-thione (PubChem CID 9243233) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4-[[(3R)-3-hydroxypiperidin-1-yl]methyl]tetrazole-5-thione.
| Compound Name | 1-(3,4-dimethylphenyl)-4-[[(3R)-3-hydroxypiperidin-1-yl]methyl]tetrazole-5-thione |
|---|---|
| PubChem CID | 9243233 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4-[[(3R)-3-hydroxypiperidin-1-yl]methyl]tetrazole-5-thione |
| SMILES | Cc1ccc(-n2nnn(CN3CCC[C@@H](O)C3)c2=S)cc1C |
| InChI | InChI=1S/C15H21N5OS/c1-11-5-6-13(8-12(11)2)20-15(22)19(16-17-20)10-18-7-3-4-14(21)9-18/h5-6,8,14,21H,3-4,7,9-10H2,1-2H3/t14-/m1/s1 |
| InChIKey | USERILGWKCBJKB-CQSZACIVSA-N |
| XLogP | 1.83 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|