About methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate
methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate (PubChem CID 9243722) has the molecular formula C21H30N3O5+
and a molecular weight of 404.49 g/mol. Its IUPAC name is methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate |
| PubChem CID | 9243722 |
| Molecular Formula | C21H30N3O5+ |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate |
| SMILES | COC(=O)C1CC[NH+](CN2C(=O)C(=O)N(C34CC5CC(CC(C5)C3)C4)C2=O)CC1 |
| InChI | InChI=1S/C21H29N3O5/c1-29-19(27)16-2-4-22(5-3-16)12-23-17(25)18(26)24(20(23)28)21-9-13-6-14(10-21)8-15(7-13)11-21/h13-16H,2-12H2,1H3/p+1 |
| InChIKey | ZRIMEHUMYGOCLJ-UHFFFAOYSA-O |
| XLogP | 0.17 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate?
The IUPAC name of methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate (CID 9243722) is methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate.
What is the SMILES notation for methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate?
The canonical SMILES for methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate is COC(=O)C1CC[NH+](CN2C(=O)C(=O)N(C34CC5CC(CC(C5)C3)C4)C2=O)CC1.
What is the InChIKey of methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate?
The InChIKey is ZRIMEHUMYGOCLJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C21H29N3O5/c1-29-19(27)16-2-4-22(5-3-16)12-23-17(25)18(26)24(20(23)28)21-9-13-6-14(10-21)8-15(7-13)11-21/h13-16H,2-12H2,1H3/p+1.
What are the key properties of methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate?
methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate has a molecular weight of 404.49 g/mol, XLogP of 0.17, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[3-(1-adamantyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-1-ium-4-carboxylate is sourced from PubChem (CID 9243722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).