C20H18N4O2S — CID 9243948
3-[(4-methoxyphenyl)methyl]-4-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9243948) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-4-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-4-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9243948 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-4-[(Z)-(2-prop-2-ynoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | C#CCOc1ccccc1/C=N\n1c(Cc2ccc(OC)cc2)n[nH]c1=S |
| InChI | InChI=1S/C20H18N4O2S/c1-3-12-26-18-7-5-4-6-16(18)14-21-24-19(22-23-20(24)27)13-15-8-10-17(25-2)11-9-15/h1,4-11,14H,12-13H2,2H3,(H,23,27)/b21-14- |
| InChIKey | ODNINBYDZKHYMM-STZFKDTASA-N |
| XLogP | 3.43 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|