C21H24N2O4S — CID 9244621
N-(3-acetylphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 9244621) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-(3-acetylphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 9244621 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-(3-acetylphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)CCc2ccc(S(=O)(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C21H24N2O4S/c1-16(24)18-5-4-6-19(15-18)22-21(25)12-9-17-7-10-20(11-8-17)28(26,27)23-13-2-3-14-23/h4-8,10-11,15H,2-3,9,12-14H2,1H3,(H,22,25) |
| InChIKey | DNOZALXLRLVQLK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |