C24H21N3O4 — CID 9244698
4-[[(2R)-2-(4-cyanophenoxy)propanoyl]amino]-N-(2-methoxyphenyl)benzamide (PubChem CID 9244698) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 4-[[(2R)-2-(4-cyanophenoxy)propanoyl]amino]-N-(2-methoxyphenyl)benzamide.
| Compound Name | 4-[[(2R)-2-(4-cyanophenoxy)propanoyl]amino]-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 9244698 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 4-[[(2R)-2-(4-cyanophenoxy)propanoyl]amino]-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)[C@@H](C)Oc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C24H21N3O4/c1-16(31-20-13-7-17(15-25)8-14-20)23(28)26-19-11-9-18(10-12-19)24(29)27-21-5-3-4-6-22(21)30-2/h3-14,16H,1-2H3,(H,26,28)(H,27,29)/t16-/m1/s1 |
| InChIKey | MVUOQNWOKFTBIH-MRXNPFEDSA-N |
| XLogP | 4.23 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |